C31H49ClN2O3 — CID 87951677
(Z)-N-[4-chloro-3-[(4,4-dimethyl-3-oxopentanoyl)amino]phenyl]octadec-9-enamide (PubChem CID 87951677) has the molecular formula C31H49ClN2O3 and a molecular weight of 533.20 g/mol. Its IUPAC name is (Z)-N-[4-chloro-3-[(4,4-dimethyl-3-oxopentanoyl)amino]phenyl]octadec-9-enamide.
| Compound Name | (Z)-N-[4-chloro-3-[(4,4-dimethyl-3-oxopentanoyl)amino]phenyl]octadec-9-enamide |
|---|---|
| PubChem CID | 87951677 |
| Molecular Formula | C31H49ClN2O3 |
| Molecular Weight | 533.20 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (Z)-N-[4-chloro-3-[(4,4-dimethyl-3-oxopentanoyl)amino]phenyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1ccc(Cl)c(NC(=O)CC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C31H49ClN2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-29(36)33-25-21-22-26(32)27(23-25)34-30(37)24-28(35)31(2,3)4/h12-13,21-23H,5-11,14-20,24H2,1-4H3,(H,33,36)(H,34,37)/b13-12- |
| InChIKey | ATYHGFQYOBSMRC-SEYXRHQNSA-N |
| XLogP | 9.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.20 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|