C23H26N4O4S — CID 87952172
tert-butyl N-[4-[4-[[2-(4-methoxyanilino)acetyl]amino]phenyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 87952172) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-(4-methoxyanilino)acetyl]amino]phenyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-(4-methoxyanilino)acetyl]amino]phenyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 87952172 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-(4-methoxyanilino)acetyl]amino]phenyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(-c3csc(NC(=O)OC(C)(C)C)n3)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O4S/c1-23(2,3)31-22(29)27-21-26-19(14-32-21)15-5-7-17(8-6-15)25-20(28)13-24-16-9-11-18(30-4)12-10-16/h5-12,14,24H,13H2,1-4H3,(H,25,28)(H,26,27,29) |
| InChIKey | HQDNPSSDWVCCMC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|