C24H26F3N5O4 — CID 87952282
N-[[4-methyl-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]-[3-(1-methylpiperidin-4-yl)-4-pyridinyl]methyl]formamide (PubChem CID 87952282) has the molecular formula C24H26F3N5O4 and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[[4-methyl-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]-[3-(1-methylpiperidin-4-yl)-4-pyridinyl]methyl]formamide.
| Compound Name | N-[[4-methyl-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]-[3-(1-methylpiperidin-4-yl)-4-pyridinyl]methyl]formamide |
|---|---|
| PubChem CID | 87952282 |
| Molecular Formula | C24H26F3N5O4 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[[4-methyl-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]imidazolidin-4-yl]-[3-(1-methylpiperidin-4-yl)-4-pyridinyl]methyl]formamide |
| SMILES | CN1CCC(c2cnccc2C(NC=O)C2(C)NC(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C24H26F3N5O4/c1-23(20(29-14-33)18-7-10-28-13-19(18)15-8-11-31(2)12-9-15)21(34)32(22(35)30-23)16-3-5-17(6-4-16)36-24(25,26)27/h3-7,10,13-15,20H,8-9,11-12H2,1-2H3,(H,29,33)(H,30,35) |
| InChIKey | HVXMEVFNARESDS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|