About N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide
N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide (PubChem CID 87952681) has the molecular formula C16H29N5O2S
and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide.
Molecular Properties
| Compound Name | N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide |
| PubChem CID | 87952681 |
| Molecular Formula | C16H29N5O2S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide |
| SMILES | CC(C)CC(=O)N1CCC([NH+]([O-])NCCN2CSCC2C#N)CC1 |
| InChI | InChI=1S/C16H29N5O2S/c1-13(2)9-16(22)19-6-3-14(4-7-19)21(23)18-5-8-20-12-24-11-15(20)10-17/h13-15,18,21H,3-9,11-12H2,1-2H3 |
| InChIKey | AMZXEDFELSADJM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide?
The IUPAC name of N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide (CID 87952681) is N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide.
What is the SMILES notation for N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide?
The canonical SMILES for N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide is CC(C)CC(=O)N1CCC([NH+]([O-])NCCN2CSCC2C#N)CC1.
What is the InChIKey of N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide?
The InChIKey is AMZXEDFELSADJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N5O2S/c1-13(2)9-16(22)19-6-3-14(4-7-19)21(23)18-5-8-20-12-24-11-15(20)10-17/h13-15,18,21H,3-9,11-12H2,1-2H3.
What are the key properties of N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide?
N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide has a molecular weight of 355.51 g/mol, XLogP of -0.19, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-cyano-1,3-thiazolidin-3-yl)ethylamino]-1-(3-methylbutanoyl)piperidin-4-amine oxide is sourced from PubChem (CID 87952681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).