C18H25N5O2 — CID 87953358
N-[5-(cyanomethylamino)-3-methyl-5-oxopentyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide (PubChem CID 87953358) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[5-(cyanomethylamino)-3-methyl-5-oxopentyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide.
| Compound Name | N-[5-(cyanomethylamino)-3-methyl-5-oxopentyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 87953358 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[5-(cyanomethylamino)-3-methyl-5-oxopentyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide |
| SMILES | CC(CCNC(=O)c1ccnc(N2CCCC2)c1)CC(=O)NCC#N |
| InChI | InChI=1S/C18H25N5O2/c1-14(12-17(24)21-9-6-19)4-7-22-18(25)15-5-8-20-16(13-15)23-10-2-3-11-23/h5,8,13-14H,2-4,7,9-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | PFQWHYXAZIAXER-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|