C12H13F6O5PS — CID 87953540
1,1,1,4,4,4-hexafluorobutan-2-yloxy-[(4-methylsulfonylphenyl)methyl]phosphinic acid (PubChem CID 87953540) has the molecular formula C12H13F6O5PS and a molecular weight of 414.26 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutan-2-yloxy-[(4-methylsulfonylphenyl)methyl]phosphinic acid.
| Compound Name | 1,1,1,4,4,4-hexafluorobutan-2-yloxy-[(4-methylsulfonylphenyl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87953540 |
| Molecular Formula | C12H13F6O5PS |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutan-2-yloxy-[(4-methylsulfonylphenyl)methyl]phosphinic acid |
| SMILES | CS(=O)(=O)c1ccc(CP(=O)(O)OC(CC(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F6O5PS/c1-25(21,22)9-4-2-8(3-5-9)7-24(19,20)23-10(12(16,17)18)6-11(13,14)15/h2-5,10H,6-7H2,1H3,(H,19,20) |
| InChIKey | HVSPTPXEAIAOFQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|