About (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one
(3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one (PubChem CID 87954170) has the molecular formula C21H46O3Si2
and a molecular weight of 402.77 g/mol. Its IUPAC name is (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one.
Molecular Properties
| Compound Name | (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one |
| PubChem CID | 87954170 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one |
| SMILES | CC[Si](CC)(OCC[C@H](O[Si](CC)(CC)C(C)(C)C)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-12-25(13-2,20(6,7)8)23-17-16-19(18(5)22)24-26(14-3,15-4)21(9,10)11/h19H,12-17H2,1-11H3/t19-/m0/s1 |
| InChIKey | ULVAZCRJOGQQQJ-IBGZPJMESA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one?
The IUPAC name of (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one (CID 87954170) is (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one.
What is the SMILES notation for (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one?
The canonical SMILES for (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one is CC[Si](CC)(OCC[C@H](O[Si](CC)(CC)C(C)(C)C)C(C)=O)C(C)(C)C.
What is the InChIKey of (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one?
The InChIKey is ULVAZCRJOGQQQJ-IBGZPJMESA-N. The full InChI is InChI=1S/C21H46O3Si2/c1-12-25(13-2,20(6,7)8)23-17-16-19(18(5)22)24-26(14-3,15-4)21(9,10)11/h19H,12-17H2,1-11H3/t19-/m0/s1.
What are the key properties of (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one?
(3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one has a molecular weight of 402.77 g/mol, XLogP of 6.94, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,5-bis[[tert-butyl(diethyl)silyl]oxy]pentan-2-one is sourced from PubChem (CID 87954170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).