C31H41Cl2F6N5O3 — CID 87954293
(3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;dihydrochloride (PubChem CID 87954293) has the molecular formula C31H41Cl2F6N5O3 and a molecular weight of 716.60 g/mol. Its IUPAC name is (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;dihydrochloride.
| Compound Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 87954293 |
| Molecular Formula | C31H41Cl2F6N5O3 |
| Molecular Weight | 716.60 g/mol |
| Exact Mass | 715.25 |
| IUPAC Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;dihydrochloride |
| SMILES | CCCCN1C(=O)[C@@H]([C@H](O)C2CCCCC2)NC(=O)C12CCN(Cc1c(C(F)(F)F)nn(-c3ccccc3)c1C(F)(F)F)CC2.Cl.Cl |
| InChI | InChI=1S/C31H39F6N5O3.2ClH/c1-2-3-16-41-27(44)23(24(43)20-10-6-4-7-11-20)38-28(45)29(41)14-17-40(18-15-29)19-22-25(30(32,33)34)39-42(26(22)31(35,36)37)21-12-8-5-9-13-21;;/h5,8-9,12-13,20,23-24,43H,2-4,6-7,10-11,14-19H2,1H3,(H,38,45);2*1H/t23-,24-;;/m1../s1 |
| InChIKey | ZVKIJEXEJNVTSC-NILKIKDOSA-N |
| XLogP | 6.16 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |