C31H39F6N5O3 — CID 87954295
(3R)-1-butyl-3-[(1-hydroxycyclohexyl)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 87954295) has the molecular formula C31H39F6N5O3 and a molecular weight of 643.67 g/mol. Its IUPAC name is (3R)-1-butyl-3-[(1-hydroxycyclohexyl)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-3-[(1-hydroxycyclohexyl)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 87954295 |
| Molecular Formula | C31H39F6N5O3 |
| Molecular Weight | 643.67 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | (3R)-1-butyl-3-[(1-hydroxycyclohexyl)methyl]-9-[[1-phenyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H](CC2(O)CCCCC2)NC(=O)C12CCN(Cc1c(C(F)(F)F)nn(-c3ccccc3)c1C(F)(F)F)CC2 |
| InChI | InChI=1S/C31H39F6N5O3/c1-2-3-16-41-26(43)23(19-28(45)12-8-5-9-13-28)38-27(44)29(41)14-17-40(18-15-29)20-22-24(30(32,33)34)39-42(25(22)31(35,36)37)21-10-6-4-7-11-21/h4,6-7,10-11,23,45H,2-3,5,8-9,12-20H2,1H3,(H,38,44)/t23-/m1/s1 |
| InChIKey | ZRHWIFVTYNXMAY-HSZRJFAPSA-N |
| XLogP | 5.46 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |