About carbonic acid;2-methylpropan-2-ol
carbonic acid;2-methylpropan-2-ol (PubChem CID 87955021) has the molecular formula C6H14O7
and a molecular weight of 198.17 g/mol. Its IUPAC name is carbonic acid;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | carbonic acid;2-methylpropan-2-ol |
| PubChem CID | 87955021 |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | carbonic acid;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C4H10O.2CH2O3/c1-4(2,3)5;2*2-1(3)4/h5H,1-3H3;2*(H2,2,3,4) |
| InChIKey | ZTPJXJOWYTYQLP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;2-methylpropan-2-ol?
The IUPAC name of carbonic acid;2-methylpropan-2-ol (CID 87955021) is carbonic acid;2-methylpropan-2-ol.
What is the SMILES notation for carbonic acid;2-methylpropan-2-ol?
The canonical SMILES for carbonic acid;2-methylpropan-2-ol is CC(C)(C)O.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;2-methylpropan-2-ol?
The InChIKey is ZTPJXJOWYTYQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.2CH2O3/c1-4(2,3)5;2*2-1(3)4/h5H,1-3H3;2*(H2,2,3,4).
What are the key properties of carbonic acid;2-methylpropan-2-ol?
carbonic acid;2-methylpropan-2-ol has a molecular weight of 198.17 g/mol, XLogP of 1.22, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-methylpropan-2-ol is sourced from PubChem (CID 87955021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).