C24H27F2N5O5S2 — CID 87955305
butyl N-[2-[[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]sulfonylamino]ethyl]-N-methylcarbamate (PubChem CID 87955305) has the molecular formula C24H27F2N5O5S2 and a molecular weight of 567.64 g/mol. Its IUPAC name is butyl N-[2-[[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]sulfonylamino]ethyl]-N-methylcarbamate.
| Compound Name | butyl N-[2-[[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]sulfonylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87955305 |
| Molecular Formula | C24H27F2N5O5S2 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | butyl N-[2-[[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]sulfonylamino]ethyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)CCNS(=O)(=O)c1ccc(Nc2nc(N)c(C(=O)c3c(F)cccc3F)s2)cc1 |
| InChI | InChI=1S/C24H27F2N5O5S2/c1-3-4-14-36-24(33)31(2)13-12-28-38(34,35)16-10-8-15(9-11-16)29-23-30-22(27)21(37-23)20(32)19-17(25)6-5-7-18(19)26/h5-11,28H,3-4,12-14,27H2,1-2H3,(H,29,30) |
| InChIKey | KLMXHYXQPHMNFG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|