C42H40N6O8S — CID 87955513
(E)-1-(4-acetylpiperazin-1-yl)-3-[4-[4-[(E)-3-(4-acetylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-nitro-3-phenylphenyl]sulfanyl-3-nitro-2-phenylphenyl]prop-2-en-1-one (PubChem CID 87955513) has the molecular formula C42H40N6O8S and a molecular weight of 788.88 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[4-[(E)-3-(4-acetylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-nitro-3-phenylphenyl]sulfanyl-3-nitro-2-phenylphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[4-[(E)-3-(4-acetylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-nitro-3-phenylphenyl]sulfanyl-3-nitro-2-phenylphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 87955513 |
| Molecular Formula | C42H40N6O8S |
| Molecular Weight | 788.88 g/mol |
| Exact Mass | 788.26 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-3-[4-[4-[(E)-3-(4-acetylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-nitro-3-phenylphenyl]sulfanyl-3-nitro-2-phenylphenyl]prop-2-en-1-one |
| SMILES | CC(=O)N1CCN(C(=O)/C=C/c2ccc(Sc3ccc(/C=C/C(=O)N4CCN(C(C)=O)CC4)c(-c4ccccc4)c3[N+](=O)[O-])c([N+](=O)[O-])c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C42H40N6O8S/c1-29(49)43-21-25-45(26-22-43)37(51)19-15-33-13-17-35(41(47(53)54)39(33)31-9-5-3-6-10-31)57-36-18-14-34(40(42(36)48(55)56)32-11-7-4-8-12-32)16-20-38(52)46-27-23-44(24-28-46)30(2)50/h3-20H,21-28H2,1-2H3/b19-15+,20-16+ |
| InChIKey | WWYVAXTVDYEYQP-MXWIWYRXSA-N |
| XLogP | 6.40 |
| TPSA | 167.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.88 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|