C16H16F2N4O2S2 — CID 87955684
4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbothioic S-acid (PubChem CID 87955684) has the molecular formula C16H16F2N4O2S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbothioic S-acid.
| Compound Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 87955684 |
| Molecular Formula | C16H16F2N4O2S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]piperidine-1-carbothioic S-acid |
| SMILES | Nc1nc(NC2CCN(C(=O)S)CC2)sc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H16F2N4O2S2/c17-9-2-1-3-10(18)11(9)12(23)13-14(19)21-15(26-13)20-8-4-6-22(7-5-8)16(24)25/h1-3,8H,4-7,19H2,(H,20,21)(H,24,25) |
| InChIKey | HWFZLWKSMUSTFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|