C24H25F2NO3S — CID 87955818
1-[(E)-3-[2,3-difluoro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 87955818) has the molecular formula C24H25F2NO3S and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[(E)-3-[2,3-difluoro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(E)-3-[2,3-difluoro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 87955818 |
| Molecular Formula | C24H25F2NO3S |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[(E)-3-[2,3-difluoro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)c1ccccc1Sc1ccc(/C=C/C(=O)N2CCCC(C(=O)O)C2)c(F)c1F |
| InChI | InChI=1S/C24H25F2NO3S/c1-15(2)18-7-3-4-8-19(18)31-20-11-9-16(22(25)23(20)26)10-12-21(28)27-13-5-6-17(14-27)24(29)30/h3-4,7-12,15,17H,5-6,13-14H2,1-2H3,(H,29,30)/b12-10+ |
| InChIKey | SWSWLLUUABFFGE-ZRDIBKRKSA-N |
| XLogP | 5.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|