C23H26ClN3O5S — CID 87956058
[chloro-[[4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]carbamoyl] (2R)-2-methoxypyrrolidine-2-carboxylate (PubChem CID 87956058) has the molecular formula C23H26ClN3O5S and a molecular weight of 492.00 g/mol. Its IUPAC name is [chloro-[[4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]carbamoyl] (2R)-2-methoxypyrrolidine-2-carboxylate.
| Compound Name | [chloro-[[4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]carbamoyl] (2R)-2-methoxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87956058 |
| Molecular Formula | C23H26ClN3O5S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [chloro-[[4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]carbamoyl] (2R)-2-methoxypyrrolidine-2-carboxylate |
| SMILES | CO[C@@]1(C(=O)OC(=O)N(Cl)Cc2ccc(C(=O)N3CCCCc4sccc43)cc2)CCCN1 |
| InChI | InChI=1S/C23H26ClN3O5S/c1-31-23(11-4-12-25-23)21(29)32-22(30)27(24)15-16-6-8-17(9-7-16)20(28)26-13-3-2-5-19-18(26)10-14-33-19/h6-10,14,25H,2-5,11-13,15H2,1H3/t23-/m1/s1 |
| InChIKey | ATZPPMYVHDVBMM-HSZRJFAPSA-N |
| XLogP | 4.08 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|