C19H33NO4 — CID 87956595
tert-butyl (4S)-4-[(R)-[(1E)-cycloocten-1-yl]-hydroxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 87956595) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(R)-[(1E)-cycloocten-1-yl]-hydroxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(R)-[(1E)-cycloocten-1-yl]-hydroxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 87956595 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl (4S)-4-[(R)-[(1E)-cycloocten-1-yl]-hydroxymethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](O)/C2=C/CCCCCC2)COC1(C)C |
| InChI | InChI=1S/C19H33NO4/c1-18(2,3)24-17(22)20-15(13-23-19(20,4)5)16(21)14-11-9-7-6-8-10-12-14/h11,15-16,21H,6-10,12-13H2,1-5H3/b14-11+/t15-,16+/m0/s1 |
| InChIKey | XBHJXOZQRWVSIS-QNHDLBPPSA-N |
| XLogP | 4.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|