C27H38FNO6 — CID 87956837
3-(1-fluoro-2-pyridin-2-ylethenyl)-1,2-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87956837) has the molecular formula C27H38FNO6 and a molecular weight of 491.60 g/mol. Its IUPAC name is 3-(1-fluoro-2-pyridin-2-ylethenyl)-1,2-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-1,2-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87956837 |
| Molecular Formula | C27H38FNO6 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 3-(1-fluoro-2-pyridin-2-ylethenyl)-1,2-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CCCC2(C)OC2(O)C(O)C(C(F)=Cc2ccccn2)OC(=O)CCC(C)(C)C(=O)C(C)C1 |
| InChI | InChI=1S/C27H38FNO6/c1-17-9-8-12-26(5)27(33,35-26)24(32)22(20(28)16-19-10-6-7-14-29-19)34-21(30)11-13-25(3,4)23(31)18(2)15-17/h6-7,10,14,16-18,22,24,32-33H,8-9,11-13,15H2,1-5H3 |
| InChIKey | NELKDVYPQUQJRA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|