C12H9F6N3O — CID 87956901
1,2-bis(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide (PubChem CID 87956901) has the molecular formula C12H9F6N3O and a molecular weight of 325.21 g/mol. Its IUPAC name is 1,2-bis(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide.
| Compound Name | 1,2-bis(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 87956901 |
| Molecular Formula | C12H9F6N3O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1,2-bis(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(CC(F)(F)F)n2CC(F)(F)F |
| InChI | InChI=1S/C12H9F6N3O/c13-11(14,15)4-9-20-7-3-6(10(19)22)1-2-8(7)21(9)5-12(16,17)18/h1-3H,4-5H2,(H2,19,22) |
| InChIKey | ONIOHLBIZBGVBM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |