About 1-(2,2-dihydroxyethyl)-1,3-dimethylurea
1-(2,2-dihydroxyethyl)-1,3-dimethylurea (PubChem CID 87957060) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(2,2-dihydroxyethyl)-1,3-dimethylurea |
| PubChem CID | 87957060 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 1-(2,2-dihydroxyethyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CC(O)O |
| InChI | InChI=1S/C5H12N2O3/c1-6-5(10)7(2)3-4(8)9/h4,8-9H,3H2,1-2H3,(H,6,10) |
| InChIKey | RAKKOSVBCSYSJP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dihydroxyethyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dihydroxyethyl)-1,3-dimethylurea?
The IUPAC name of 1-(2,2-dihydroxyethyl)-1,3-dimethylurea (CID 87957060) is 1-(2,2-dihydroxyethyl)-1,3-dimethylurea.
What is the SMILES notation for 1-(2,2-dihydroxyethyl)-1,3-dimethylurea?
The canonical SMILES for 1-(2,2-dihydroxyethyl)-1,3-dimethylurea is CNC(=O)N(C)CC(O)O.
What is the InChIKey of 1-(2,2-dihydroxyethyl)-1,3-dimethylurea?
The InChIKey is RAKKOSVBCSYSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O3/c1-6-5(10)7(2)3-4(8)9/h4,8-9H,3H2,1-2H3,(H,6,10).
What are the key properties of 1-(2,2-dihydroxyethyl)-1,3-dimethylurea?
1-(2,2-dihydroxyethyl)-1,3-dimethylurea has a molecular weight of 148.16 g/mol, XLogP of -1.43, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dihydroxyethyl)-1,3-dimethylurea is sourced from PubChem (CID 87957060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).