C28H27F3N4O7S4 — CID 87957181
(2,2,2-trifluoroacetyl) 2-acetamido-3-[2-[6-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonyl-3-methyl-2-phenylanilino]-2-oxoethyl]sulfanylpropanoate (PubChem CID 87957181) has the molecular formula C28H27F3N4O7S4 and a molecular weight of 716.81 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-acetamido-3-[2-[6-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonyl-3-methyl-2-phenylanilino]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-acetamido-3-[2-[6-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonyl-3-methyl-2-phenylanilino]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 87957181 |
| Molecular Formula | C28H27F3N4O7S4 |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 716.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-acetamido-3-[2-[6-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonyl-3-methyl-2-phenylanilino]-2-oxoethyl]sulfanylpropanoate |
| SMILES | [H]/N=C(\N)c1cc(S(=O)(=O)c2ccc(C)c(-c3ccccc3)c2NC(=O)CSCC(NC(C)=O)C(=O)OC(=O)C(F)(F)F)c(SC)s1 |
| InChI | InChI=1S/C28H27F3N4O7S4/c1-14-9-10-19(46(40,41)20-11-18(24(32)33)45-26(20)43-3)23(22(14)16-7-5-4-6-8-16)35-21(37)13-44-12-17(34-15(2)36)25(38)42-27(39)28(29,30)31/h4-11,17H,12-13H2,1-3H3,(H3,32,33)(H,34,36)(H,35,37) |
| InChIKey | OWUKZBUMZARPEE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 185.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|