About [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate
[(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate (PubChem CID 87957533) has the molecular formula C19H28O6
and a molecular weight of 352.43 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate |
| PubChem CID | 87957533 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate |
| SMILES | C=C/C=C/OC(C)=O.CCCCOC(=O)C1CCC=CC1OC(C)=O |
| InChI | InChI=1S/C13H20O4.C6H8O2/c1-3-4-9-16-13(15)11-7-5-6-8-12(11)17-10(2)14;1-3-4-5-8-6(2)7/h6,8,11-12H,3-5,7,9H2,1-2H3;3-5H,1H2,2H3/b;5-4+ |
| InChIKey | GZHSWOPCLYKSHH-RCKHEGBHSA-N |
| XLogP | 3.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate?
The IUPAC name of [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate (CID 87957533) is [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate.
What is the SMILES notation for [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate?
The canonical SMILES for [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate is C=C/C=C/OC(C)=O.CCCCOC(=O)C1CCC=CC1OC(C)=O.
What is the InChIKey of [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate?
The InChIKey is GZHSWOPCLYKSHH-RCKHEGBHSA-N. The full InChI is InChI=1S/C13H20O4.C6H8O2/c1-3-4-9-16-13(15)11-7-5-6-8-12(11)17-10(2)14;1-3-4-5-8-6(2)7/h6,8,11-12H,3-5,7,9H2,1-2H3;3-5H,1H2,2H3/b;5-4+.
What are the key properties of [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate?
[(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate has a molecular weight of 352.43 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-buta-1,3-dienyl] acetate;butyl 2-acetyloxycyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 87957533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).