C18H28BrN3O2 — CID 8795783
N-[(1S)-1-(4-bromophenyl)ethyl]-2-[[2-(tert-butylamino)-2-oxoethyl]-ethylamino]acetamide (PubChem CID 8795783) has the molecular formula C18H28BrN3O2 and a molecular weight of 398.35 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-2-[[2-(tert-butylamino)-2-oxoethyl]-ethylamino]acetamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-[[2-(tert-butylamino)-2-oxoethyl]-ethylamino]acetamide |
|---|---|
| PubChem CID | 8795783 |
| Molecular Formula | C18H28BrN3O2 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-[[2-(tert-butylamino)-2-oxoethyl]-ethylamino]acetamide |
| SMILES | CCN(CC(=O)N[C@@H](C)c1ccc(Br)cc1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28BrN3O2/c1-6-22(12-17(24)21-18(3,4)5)11-16(23)20-13(2)14-7-9-15(19)10-8-14/h7-10,13H,6,11-12H2,1-5H3,(H,20,23)(H,21,24)/t13-/m0/s1 |
| InChIKey | SHDVSXBFNNEBNH-ZDUSSCGKSA-N |
| XLogP | 2.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |