C11H16F3NO5S — CID 87958626
[4-(trifluoromethylsulfonyloxy)-1,2,3,6-tetrahydropyridin-2-yl] 2,2-dimethylpropanoate (PubChem CID 87958626) has the molecular formula C11H16F3NO5S and a molecular weight of 331.31 g/mol. Its IUPAC name is [4-(trifluoromethylsulfonyloxy)-1,2,3,6-tetrahydropyridin-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(trifluoromethylsulfonyloxy)-1,2,3,6-tetrahydropyridin-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87958626 |
| Molecular Formula | C11H16F3NO5S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [4-(trifluoromethylsulfonyloxy)-1,2,3,6-tetrahydropyridin-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CC(OS(=O)(=O)C(F)(F)F)=CCN1 |
| InChI | InChI=1S/C11H16F3NO5S/c1-10(2,3)9(16)19-8-6-7(4-5-15-8)20-21(17,18)11(12,13)14/h4,8,15H,5-6H2,1-3H3 |
| InChIKey | FNQHSZGRCCYAPT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|