C11H16F4N2O3 — CID 87959145
[(3R)-3-methyl-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)pentan-2-yl]carbamic acid (PubChem CID 87959145) has the molecular formula C11H16F4N2O3 and a molecular weight of 300.25 g/mol. Its IUPAC name is [(3R)-3-methyl-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)pentan-2-yl]carbamic acid.
| Compound Name | [(3R)-3-methyl-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87959145 |
| Molecular Formula | C11H16F4N2O3 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(3R)-3-methyl-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)pentan-2-yl]carbamic acid |
| SMILES | CC[C@@H](C)C(NC(=O)O)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C11H16F4N2O3/c1-3-6(2)7(16-9(19)20)8(18)17-4-10(12,13)11(14,15)5-17/h6-7,16H,3-5H2,1-2H3,(H,19,20)/t6-,7?/m1/s1 |
| InChIKey | BYCJBRNRBBLUOA-ULUSZKPHSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|