About (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride
(E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride (PubChem CID 87959539) has the molecular formula C5H13ClN2
and a molecular weight of 136.63 g/mol. Its IUPAC name is (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride |
| PubChem CID | 87959539 |
| Molecular Formula | C5H13ClN2 |
| Molecular Weight | 136.63 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride |
| SMILES | CN/C(C)=C(\C)N.Cl |
| InChI | InChI=1S/C5H12N2.ClH/c1-4(6)5(2)7-3;/h7H,6H2,1-3H3;1H/b5-4+; |
| InChIKey | SBENUPFSRGTLPT-FXRZFVDSSA-N |
| XLogP | 0.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.63 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride?
The IUPAC name of (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride (CID 87959539) is (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride.
What is the SMILES notation for (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride?
The canonical SMILES for (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride is CN/C(C)=C(\C)N.Cl.
What is the InChIKey of (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride?
The InChIKey is SBENUPFSRGTLPT-FXRZFVDSSA-N. The full InChI is InChI=1S/C5H12N2.ClH/c1-4(6)5(2)7-3;/h7H,6H2,1-3H3;1H/b5-4+;.
What are the key properties of (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride?
(E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride has a molecular weight of 136.63 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-N-methylbut-2-ene-2,3-diamine;hydrochloride is sourced from PubChem (CID 87959539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).