C54H56F6N2O7 — CID 87959549
2-[2-ethyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenoxy]acetic acid;4-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]butanoic acid (PubChem CID 87959549) has the molecular formula C54H56F6N2O7 and a molecular weight of 959.04 g/mol. Its IUPAC name is 2-[2-ethyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenoxy]acetic acid;4-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]butanoic acid.
| Compound Name | 2-[2-ethyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenoxy]acetic acid;4-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 87959549 |
| Molecular Formula | C54H56F6N2O7 |
| Molecular Weight | 959.04 g/mol |
| Exact Mass | 958.40 |
| IUPAC Name | 2-[2-ethyl-4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenoxy]acetic acid;4-[4-[1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]butanoic acid |
| SMILES | CCCCC(Oc1ccc(CCCC(=O)O)cc1)c1cccc(-c2ccc(C(F)(F)F)cc2)n1.CCCCC(Oc1ccc(OCC(=O)O)c(CC)c1)c1cccc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C27H28F3NO4.C27H28F3NO3/c1-3-5-9-25(35-21-14-15-24(18(4-2)16-21)34-17-26(32)33)23-8-6-7-22(31-23)19-10-12-20(13-11-19)27(28,29)30;1-2-3-9-25(34-22-17-11-19(12-18-22)6-4-10-26(32)33)24-8-5-7-23(31-24)20-13-15-21(16-14-20)27(28,29)30/h6-8,10-16,25H,3-5,9,17H2,1-2H3,(H,32,33);5,7-8,11-18,25H,2-4,6,9-10H2,1H3,(H,32,33) |
| InChIKey | BEUWPKUSNVYTAR-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.04 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |