C22H28N4Ni+3 — CID 87959854
2-N,3-N-bis(2,6-dimethylphenyl)-1,4-dimethylpiperazine-2,3-diimine;nickel(3+) (PubChem CID 87959854) has the molecular formula C22H28N4Ni+3 and a molecular weight of 407.19 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-dimethylpiperazine-2,3-diimine;nickel(3+).
| Compound Name | 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-dimethylpiperazine-2,3-diimine;nickel(3+) |
|---|---|
| PubChem CID | 87959854 |
| Molecular Formula | C22H28N4Ni+3 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-dimethylpiperazine-2,3-diimine;nickel(3+) |
| SMILES | Cc1cccc(C)c1/N=C1C(=N/c2c(C)cccc2C)/N(C)CCN/1C.[Ni+3] |
| InChI | InChI=1S/C22H28N4.Ni/c1-15-9-7-10-16(2)19(15)23-21-22(26(6)14-13-25(21)5)24-20-17(3)11-8-12-18(20)4;/h7-12H,13-14H2,1-6H3;/q;+3/b23-21-,24-22-; |
| InChIKey | XVLCDUNEDMNNEC-ZVDJXTMWSA-N |
| XLogP | 4.56 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|