C25H46O5Si — CID 87960242
tert-butyl (7R,8S)-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxyundeca-2,10-dienoate (PubChem CID 87960242) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is tert-butyl (7R,8S)-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxyundeca-2,10-dienoate.
| Compound Name | tert-butyl (7R,8S)-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxyundeca-2,10-dienoate |
|---|---|
| PubChem CID | 87960242 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | tert-butyl (7R,8S)-7-hydroxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxyundeca-2,10-dienoate |
| SMILES | C=CC[C@H](C)[C@@H](O)C(C)C(=O)C(C)(C)C(=CC(=O)OC(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H46O5Si/c1-12-16-18(5)22(27)19(6)23(28)25(10,11)20(17-21(26)29-24(7,8)9)30-31(13-2,14-3)15-4/h12,17-19,22,27H,1,13-16H2,2-11H3/t18-,19?,22+/m0/s1 |
| InChIKey | GYFNONJEXPFUDM-RAOLVUDRSA-N |
| XLogP | 6.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|