(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid

C10H7F2NO3 — CID 879606

IUPAC(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C/C(=O)Nc1ccc(F)cc1F
InChIInChI=1S/C10H7F2NO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3+
InChIKeyDVBSHLGHHLTWPZ-ONEGZZNKSA-N
MW227.17 g/mol
LogP1.54
Rot. Bonds3

About (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid

(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid (PubChem CID 879606) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid
PubChem CID879606
Molecular FormulaC10H7F2NO3
Molecular Weight227.17 g/mol
Exact Mass227.04
IUPAC Name(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C/C(=O)Nc1ccc(F)cc1F
InChIInChI=1S/C10H7F2NO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3+
InChIKeyDVBSHLGHHLTWPZ-ONEGZZNKSA-N
XLogP1.54
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.17
LogP ≤ 51.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid (CID 879606) is (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid is O=C(O)/C=C/C(=O)Nc1ccc(F)cc1F.
What is the InChIKey of (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid?
The InChIKey is DVBSHLGHHLTWPZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H7F2NO3/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3+.
What are the key properties of (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid?
(E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid has a molecular weight of 227.17 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,4-difluoroanilino)-4-oxobut-2-enoic acid is sourced from PubChem (CID 879606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).