C20H26O7S — CID 87961107
[(1R,4R,5R,8R)-8-acetyl-4-(benzenesulfonylmethyl)-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-1-yl] acetate (PubChem CID 87961107) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is [(1R,4R,5R,8R)-8-acetyl-4-(benzenesulfonylmethyl)-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-1-yl] acetate.
| Compound Name | [(1R,4R,5R,8R)-8-acetyl-4-(benzenesulfonylmethyl)-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-1-yl] acetate |
|---|---|
| PubChem CID | 87961107 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [(1R,4R,5R,8R)-8-acetyl-4-(benzenesulfonylmethyl)-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@@H](CC[C@]1(C)C(C)=O)[C@](C)(CS(=O)(=O)c1ccccc1)OO2 |
| InChI | InChI=1S/C20H26O7S/c1-14(21)18(3)11-10-16-12-20(18,25-15(2)22)27-26-19(16,4)13-28(23,24)17-8-6-5-7-9-17/h5-9,16H,10-13H2,1-4H3/t16-,18-,19+,20-/m1/s1 |
| InChIKey | HNRSOQMWHHPMHN-RSPOEFSDSA-N |
| XLogP | 2.84 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|