C18H16ClN3 — CID 87961341
16-diazotetracyclo[9.7.0.03,8.012,17]octadeca-2,4,6,8,10,14,17-heptaen-10-amine;hydrochloride (PubChem CID 87961341) has the molecular formula C18H16ClN3 and a molecular weight of 309.80 g/mol. Its IUPAC name is 16-diazotetracyclo[9.7.0.03,8.012,17]octadeca-2,4,6,8,10,14,17-heptaen-10-amine;hydrochloride.
| Compound Name | 16-diazotetracyclo[9.7.0.03,8.012,17]octadeca-2,4,6,8,10,14,17-heptaen-10-amine;hydrochloride |
|---|---|
| PubChem CID | 87961341 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 16-diazotetracyclo[9.7.0.03,8.012,17]octadeca-2,4,6,8,10,14,17-heptaen-10-amine;hydrochloride |
| SMILES | Cl.[N-]=[N+]=C1C=CCC2C1=CC1C=c3ccccc3=CC(N)=C12 |
| InChI | InChI=1S/C18H15N3.ClH/c19-16-10-12-5-2-1-4-11(12)8-13-9-15-14(18(13)16)6-3-7-17(15)21-20;/h1-5,7-10,13-14H,6,19H2;1H |
| InChIKey | ZQMNPWBIGIFBBK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|