About 1-(1,2,2-trifluoroethenyl)cyclobutene
1-(1,2,2-trifluoroethenyl)cyclobutene (PubChem CID 87961377) has the molecular formula C6H5F3
and a molecular weight of 134.10 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethenyl)cyclobutene.
Molecular Properties
| Compound Name | 1-(1,2,2-trifluoroethenyl)cyclobutene |
| PubChem CID | 87961377 |
| Molecular Formula | C6H5F3 |
| Molecular Weight | 134.10 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 1-(1,2,2-trifluoroethenyl)cyclobutene |
| SMILES | FC(F)=C(F)C1=CCC1 |
| InChI | InChI=1S/C6H5F3/c7-5(6(8)9)4-2-1-3-4/h2H,1,3H2 |
| InChIKey | PDSCTYSZASDYRP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(1,2,2-trifluoroethenyl)cyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,2-trifluoroethenyl)cyclobutene?
The IUPAC name of 1-(1,2,2-trifluoroethenyl)cyclobutene (CID 87961377) is 1-(1,2,2-trifluoroethenyl)cyclobutene.
What is the SMILES notation for 1-(1,2,2-trifluoroethenyl)cyclobutene?
The canonical SMILES for 1-(1,2,2-trifluoroethenyl)cyclobutene is FC(F)=C(F)C1=CCC1.
What is the InChIKey of 1-(1,2,2-trifluoroethenyl)cyclobutene?
The InChIKey is PDSCTYSZASDYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3/c7-5(6(8)9)4-2-1-3-4/h2H,1,3H2.
What are the key properties of 1-(1,2,2-trifluoroethenyl)cyclobutene?
1-(1,2,2-trifluoroethenyl)cyclobutene has a molecular weight of 134.10 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,2-trifluoroethenyl)cyclobutene is sourced from PubChem (CID 87961377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).