About 1-benzothiophen-2-yl benzenesulfonate
1-benzothiophen-2-yl benzenesulfonate (PubChem CID 87961440) has the molecular formula C14H10O3S2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-benzothiophen-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | 1-benzothiophen-2-yl benzenesulfonate |
| PubChem CID | 87961440 |
| Molecular Formula | C14H10O3S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-benzothiophen-2-yl benzenesulfonate |
| SMILES | O=S(=O)(Oc1cc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C14H10O3S2/c15-19(16,12-7-2-1-3-8-12)17-14-10-11-6-4-5-9-13(11)18-14/h1-10H |
| InChIKey | IBDQRIQOCHZCSB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophen-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-2-yl benzenesulfonate?
The IUPAC name of 1-benzothiophen-2-yl benzenesulfonate (CID 87961440) is 1-benzothiophen-2-yl benzenesulfonate.
What is the SMILES notation for 1-benzothiophen-2-yl benzenesulfonate?
The canonical SMILES for 1-benzothiophen-2-yl benzenesulfonate is O=S(=O)(Oc1cc2ccccc2s1)c1ccccc1.
What is the InChIKey of 1-benzothiophen-2-yl benzenesulfonate?
The InChIKey is IBDQRIQOCHZCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O3S2/c15-19(16,12-7-2-1-3-8-12)17-14-10-11-6-4-5-9-13(11)18-14/h1-10H.
What are the key properties of 1-benzothiophen-2-yl benzenesulfonate?
1-benzothiophen-2-yl benzenesulfonate has a molecular weight of 290.37 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-2-yl benzenesulfonate is sourced from PubChem (CID 87961440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).