About 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione
6,6a-dihydrocyclopenta[c]furan-1,3,5-trione (PubChem CID 87961576) has the molecular formula C7H4O4
and a molecular weight of 152.10 g/mol. Its IUPAC name is 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione.
Molecular Properties
| Compound Name | 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione |
| PubChem CID | 87961576 |
| Molecular Formula | C7H4O4 |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione |
| SMILES | O=C1C=C2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C7H4O4/c8-3-1-4-5(2-3)7(10)11-6(4)9/h1,5H,2H2 |
| InChIKey | HJCFWNHOIBORLC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione?
The IUPAC name of 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione (CID 87961576) is 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione.
What is the SMILES notation for 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione?
The canonical SMILES for 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione is O=C1C=C2C(=O)OC(=O)C2C1.
What is the InChIKey of 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione?
The InChIKey is HJCFWNHOIBORLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O4/c8-3-1-4-5(2-3)7(10)11-6(4)9/h1,5H,2H2.
What are the key properties of 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione?
6,6a-dihydrocyclopenta[c]furan-1,3,5-trione has a molecular weight of 152.10 g/mol, XLogP of -0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6a-dihydrocyclopenta[c]furan-1,3,5-trione is sourced from PubChem (CID 87961576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).