C22H15F3N2S2 — CID 87961847
4-(6-methyl-3-pyridinyl)-9-(trifluoromethyl)-3,13-dithia-5-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,7,9,11,14,16-heptaene (PubChem CID 87961847) has the molecular formula C22H15F3N2S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 4-(6-methyl-3-pyridinyl)-9-(trifluoromethyl)-3,13-dithia-5-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,7,9,11,14,16-heptaene.
| Compound Name | 4-(6-methyl-3-pyridinyl)-9-(trifluoromethyl)-3,13-dithia-5-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,7,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 87961847 |
| Molecular Formula | C22H15F3N2S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-(6-methyl-3-pyridinyl)-9-(trifluoromethyl)-3,13-dithia-5-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,4,7,9,11,14,16-heptaene |
| SMILES | Cc1ccc(C2=NCC3=CC(C(F)(F)F)=CC4=C5SC=CC=C5CC4=C3S2)cn1 |
| InChI | InChI=1S/C22H15F3N2S2/c1-12-4-5-14(10-26-12)21-27-11-15-7-16(22(23,24)25)9-18-17(20(15)29-21)8-13-3-2-6-28-19(13)18/h2-7,9-10H,8,11H2,1H3 |
| InChIKey | YFTFRUXTLQMBBE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |