C19H23BrN2O3 — CID 8796210
2-(4-bromophenoxy)-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 8796210) has the molecular formula C19H23BrN2O3 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8796210 |
| Molecular Formula | C19H23BrN2O3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc([C@H](CNC(=O)COc2ccc(Br)cc2)N(C)C)c1 |
| InChI | InChI=1S/C19H23BrN2O3/c1-22(2)18(14-5-4-6-17(11-14)24-3)12-21-19(23)13-25-16-9-7-15(20)8-10-16/h4-11,18H,12-13H2,1-3H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | BMUQJDCOTPDJAO-SFHVURJKSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |