C2H12O7P2S2 — CID 87962194
ethanol;sulfanylphosphonic acid;trihydroxy(sulfanylidene)-λ5-phosphane (PubChem CID 87962194) has the molecular formula C2H12O7P2S2 and a molecular weight of 274.19 g/mol. Its IUPAC name is ethanol;sulfanylphosphonic acid;trihydroxy(sulfanylidene)-λ5-phosphane.
| Compound Name | ethanol;sulfanylphosphonic acid;trihydroxy(sulfanylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 87962194 |
| Molecular Formula | C2H12O7P2S2 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | ethanol;sulfanylphosphonic acid;trihydroxy(sulfanylidene)-λ5-phosphane |
| SMILES | CCO.O=P(O)(O)S.OP(O)(O)=S |
| InChI | InChI=1S/C2H6O.2H3O3PS/c1-2-3;2*1-4(2,3)5/h3H,2H2,1H3;2*(H3,1,2,3,5) |
| InChIKey | ZDZJCTWGUFIVOT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|