About carbamoylurea;perylene-3-carbonitrile
carbamoylurea;perylene-3-carbonitrile (PubChem CID 87962233) has the molecular formula C23H16N4O2
and a molecular weight of 380.41 g/mol. Its IUPAC name is carbamoylurea;perylene-3-carbonitrile.
Molecular Properties
| Compound Name | carbamoylurea;perylene-3-carbonitrile |
| PubChem CID | 87962233 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | carbamoylurea;perylene-3-carbonitrile |
| SMILES | N#Cc1ccc2c3cccc4cccc(c5cccc1c52)c43.NC(=O)NC(N)=O |
| InChI | InChI=1S/C21H11N.C2H5N3O2/c22-12-14-10-11-19-17-8-2-5-13-4-1-7-16(20(13)17)18-9-3-6-15(14)21(18)19;3-1(6)5-2(4)7/h1-11H;(H5,3,4,5,6,7) |
| InChIKey | ORHOPZBMAMHQQK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze carbamoylurea;perylene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylurea;perylene-3-carbonitrile?
The IUPAC name of carbamoylurea;perylene-3-carbonitrile (CID 87962233) is carbamoylurea;perylene-3-carbonitrile.
What is the SMILES notation for carbamoylurea;perylene-3-carbonitrile?
The canonical SMILES for carbamoylurea;perylene-3-carbonitrile is N#Cc1ccc2c3cccc4cccc(c5cccc1c52)c43.NC(=O)NC(N)=O.
What is the InChIKey of carbamoylurea;perylene-3-carbonitrile?
The InChIKey is ORHOPZBMAMHQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11N.C2H5N3O2/c22-12-14-10-11-19-17-8-2-5-13-4-1-7-16(20(13)17)18-9-3-6-15(14)21(18)19;3-1(6)5-2(4)7/h1-11H;(H5,3,4,5,6,7).
What are the key properties of carbamoylurea;perylene-3-carbonitrile?
carbamoylurea;perylene-3-carbonitrile has a molecular weight of 380.41 g/mol, XLogP of 4.34, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylurea;perylene-3-carbonitrile is sourced from PubChem (CID 87962233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).