C16H24N4O3 — CID 87963409
1-(dimethylamino)ethanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87963409) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-(dimethylamino)ethanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 1-(dimethylamino)ethanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87963409 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-(dimethylamino)ethanol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(O)N(C)C.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C4H11NO/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-4(6)5(2)3/h7H,1-6H2;4,6H,1-3H3 |
| InChIKey | RAMHJQZHKPIIQN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|