C21H15ClF2N4O3 — CID 87964409
3-(2-chlorophenyl)-N-[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 87964409) has the molecular formula C21H15ClF2N4O3 and a molecular weight of 444.83 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 87964409 |
| Molecular Formula | C21H15ClF2N4O3 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C#N)C(=O)[C@@](C)(NC(=O)c1cc(-c2ccccc2Cl)no1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H15ClF2N4O3/c1-21(20(30)28(2)11-25,18-14(23)8-5-9-15(18)24)26-19(29)17-10-16(27-31-17)12-6-3-4-7-13(12)22/h3-10H,1-2H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | RVLOLIIBAMWJGK-NRFANRHFSA-N |
| XLogP | 3.86 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|