About 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione
3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione (PubChem CID 87964414) has the molecular formula C14H20Br2O3
and a molecular weight of 396.12 g/mol. Its IUPAC name is 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione |
| PubChem CID | 87964414 |
| Molecular Formula | C14H20Br2O3 |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione |
| SMILES | CCCCCC(Br)C(CC)=C(Br)C1CC(=O)OC1=O |
| InChI | InChI=1S/C14H20Br2O3/c1-3-5-6-7-11(15)9(4-2)13(16)10-8-12(17)19-14(10)18/h10-11H,3-8H2,1-2H3 |
| InChIKey | AQQUTKXYYWHQMX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione?
The IUPAC name of 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione (CID 87964414) is 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione.
What is the SMILES notation for 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione?
The canonical SMILES for 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione is CCCCCC(Br)C(CC)=C(Br)C1CC(=O)OC1=O.
What is the InChIKey of 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione?
The InChIKey is AQQUTKXYYWHQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Br2O3/c1-3-5-6-7-11(15)9(4-2)13(16)10-8-12(17)19-14(10)18/h10-11H,3-8H2,1-2H3.
What are the key properties of 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione?
3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione has a molecular weight of 396.12 g/mol, XLogP of 4.48, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dibromo-2-ethyloct-1-enyl)oxolane-2,5-dione is sourced from PubChem (CID 87964414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).