About 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium
1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium (PubChem CID 87964576) has the molecular formula C8H9F6N2O4S2+
and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium |
| PubChem CID | 87964576 |
| Molecular Formula | C8H9F6N2O4S2+ |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium |
| SMILES | CC[n+]1cc(S(=O)(=O)C(F)(F)F)n(C)c1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F6N2O4S2/c1-3-16-4-5(21(17,18)7(9,10)11)15(2)6(16)22(19,20)8(12,13)14/h4H,3H2,1-2H3/q+1 |
| InChIKey | QCGWWVVQPLFGCP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium?
The IUPAC name of 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium (CID 87964576) is 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium.
What is the SMILES notation for 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium?
The canonical SMILES for 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium is CC[n+]1cc(S(=O)(=O)C(F)(F)F)n(C)c1S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium?
The InChIKey is QCGWWVVQPLFGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F6N2O4S2/c1-3-16-4-5(21(17,18)7(9,10)11)15(2)6(16)22(19,20)8(12,13)14/h4H,3H2,1-2H3/q+1.
What are the key properties of 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium?
1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium has a molecular weight of 375.29 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium is sourced from PubChem (CID 87964576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).