C64H46F12Si2 — CID 87964675
1-methyl-1-[2-[1-methyl-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silol-1-yl]ethyl]-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silole (PubChem CID 87964675) has the molecular formula C64H46F12Si2 and a molecular weight of 1099.22 g/mol. Its IUPAC name is 1-methyl-1-[2-[1-methyl-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silol-1-yl]ethyl]-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silole.
| Compound Name | 1-methyl-1-[2-[1-methyl-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silol-1-yl]ethyl]-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silole |
|---|---|
| PubChem CID | 87964675 |
| Molecular Formula | C64H46F12Si2 |
| Molecular Weight | 1099.22 g/mol |
| Exact Mass | 1098.29 |
| IUPAC Name | 1-methyl-1-[2-[1-methyl-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silol-1-yl]ethyl]-3,4-diphenyl-2,5-bis[4-(trifluoromethyl)phenyl]silole |
| SMILES | C[Si]1(CC[Si]2(C)C(c3ccc(C(F)(F)F)cc3)=C(c3ccccc3)C(c3ccccc3)=C2c2ccc(C(F)(F)F)cc2)C(c2ccc(C(F)(F)F)cc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C64H46F12Si2/c1-77(57(45-23-31-49(32-24-45)61(65,66)67)53(41-15-7-3-8-16-41)54(42-17-9-4-10-18-42)58(77)46-25-33-50(34-26-46)62(68,69)70)39-40-78(2)59(47-27-35-51(36-28-47)63(71,72)73)55(43-19-11-5-12-20-43)56(44-21-13-6-14-22-44)60(78)48-29-37-52(38-30-48)64(74,75)76/h3-38H,39-40H2,1-2H3 |
| InChIKey | RDLHVJSBLZYUKK-UHFFFAOYSA-N |
| XLogP | 19.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.22 |
| LogP ≤ 5 | 19.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|