C20H26F15NO3 — CID 87965068
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N,N-bis(6-hydroxyhexyl)octanamide (PubChem CID 87965068) has the molecular formula C20H26F15NO3 and a molecular weight of 613.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N,N-bis(6-hydroxyhexyl)octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N,N-bis(6-hydroxyhexyl)octanamide |
|---|---|
| PubChem CID | 87965068 |
| Molecular Formula | C20H26F15NO3 |
| Molecular Weight | 613.40 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N,N-bis(6-hydroxyhexyl)octanamide |
| SMILES | O=C(N(CCCCCCO)CCCCCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H26F15NO3/c21-14(22,13(39)36(9-5-1-3-7-11-37)10-6-2-4-8-12-38)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h37-38H,1-12H2 |
| InChIKey | USWFJOWJXWGBNP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|