About sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide
sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide (PubChem CID 87965520) has the molecular formula C14H13ClN3NaO2S
and a molecular weight of 345.79 g/mol. Its IUPAC name is sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide.
Molecular Properties
| Compound Name | sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide |
| PubChem CID | 87965520 |
| Molecular Formula | C14H13ClN3NaO2S |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H7ClNO2S.C7H6N2.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;1-2-4-7-6(3-1)8-5-9-7;/h2-5H,1H3;1-5H,(H,8,9);/q-1;;+1 |
| InChIKey | NUIZWEDXEFTDLU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide?
The IUPAC name of sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide (CID 87965520) is sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide.
What is the SMILES notation for sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide?
The canonical SMILES for sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide is Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+].c1ccc2[nH]cnc2c1.
What is the InChIKey of sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide?
The InChIKey is NUIZWEDXEFTDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClNO2S.C7H6N2.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;1-2-4-7-6(3-1)8-5-9-7;/h2-5H,1H3;1-5H,(H,8,9);/q-1;;+1.
What are the key properties of sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide?
sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide has a molecular weight of 345.79 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1H-benzimidazole;chloro-(4-methylphenyl)sulfonylazanide is sourced from PubChem (CID 87965520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).