About 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol
5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol (PubChem CID 87965581) has the molecular formula C17H36O3
and a molecular weight of 288.47 g/mol. Its IUPAC name is 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol |
| PubChem CID | 87965581 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol |
| SMILES | CCC(C)(C)CCOCCCOCCC(C)(C)CCO |
| InChI | InChI=1S/C17H36O3/c1-6-16(2,3)9-14-19-12-7-13-20-15-10-17(4,5)8-11-18/h18H,6-15H2,1-5H3 |
| InChIKey | APEQQWIJABPBEU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol?
The IUPAC name of 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol (CID 87965581) is 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol.
What is the SMILES notation for 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol?
The canonical SMILES for 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol is CCC(C)(C)CCOCCCOCCC(C)(C)CCO.
What is the InChIKey of 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol?
The InChIKey is APEQQWIJABPBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O3/c1-6-16(2,3)9-14-19-12-7-13-20-15-10-17(4,5)8-11-18/h18H,6-15H2,1-5H3.
What are the key properties of 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol?
5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol has a molecular weight of 288.47 g/mol, XLogP of 4.03, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,3-dimethylpentoxy)propoxy]-3,3-dimethylpentan-1-ol is sourced from PubChem (CID 87965581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).