C15H16F15NO3 — CID 87965865
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide (PubChem CID 87965865) has the molecular formula C15H16F15NO3 and a molecular weight of 543.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide |
|---|---|
| PubChem CID | 87965865 |
| Molecular Formula | C15H16F15NO3 |
| Molecular Weight | 543.27 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-5-(hydroxymethyl)hexyl]octanamide |
| SMILES | O=C(NCCCCC(CO)CO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F15NO3/c16-9(17,8(34)31-4-2-1-3-7(5-32)6-33)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h7,32-33H,1-6H2,(H,31,34) |
| InChIKey | OQQAQUCRPSIURA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|