C36H46N2O6S — CID 87965957
2-[3-(2-tert-butyl-7-diethylazaniumylidenechromen-4-yl)prop-2-enylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate (PubChem CID 87965957) has the molecular formula C36H46N2O6S and a molecular weight of 634.84 g/mol. Its IUPAC name is 2-[3-(2-tert-butyl-7-diethylazaniumylidenechromen-4-yl)prop-2-enylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate.
| Compound Name | 2-[3-(2-tert-butyl-7-diethylazaniumylidenechromen-4-yl)prop-2-enylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 87965957 |
| Molecular Formula | C36H46N2O6S |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 2-[3-(2-tert-butyl-7-diethylazaniumylidenechromen-4-yl)prop-2-enylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate |
| SMILES | CC[N+](CC)=c1ccc2c(C=CC=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)[O-])cc4C3(C)C)cc(C(C)(C)C)oc-2c1 |
| InChI | InChI=1S/C36H46N2O6S/c1-8-37(9-2)26-17-19-28-25(22-33(35(3,4)5)44-31(28)23-26)14-13-15-32-36(6,7)29-24-27(45(41,42)43)18-20-30(29)38(32)21-12-10-11-16-34(39)40/h13-15,17-20,22-24H,8-12,16,21H2,1-7H3,(H-,39,40,41,42,43) |
| InChIKey | ZMSXTBKPLVKZPZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|