C16H18F15NO3 — CID 87965965
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-4-(2-hydroxyethyl)hexyl]octanamide (PubChem CID 87965965) has the molecular formula C16H18F15NO3 and a molecular weight of 557.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-4-(2-hydroxyethyl)hexyl]octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-4-(2-hydroxyethyl)hexyl]octanamide |
|---|---|
| PubChem CID | 87965965 |
| Molecular Formula | C16H18F15NO3 |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[6-hydroxy-4-(2-hydroxyethyl)hexyl]octanamide |
| SMILES | O=C(NCCCC(CCO)CCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F15NO3/c17-10(18,9(35)32-5-1-2-8(3-6-33)4-7-34)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h8,33-34H,1-7H2,(H,32,35) |
| InChIKey | KQKJLSKKMJNVOX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|