C22H24N2O7P2S — CID 87966433
[1-[6-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethoxy]-1H-indol-2-yl]-2-phosphonoethyl]phosphonic acid (PubChem CID 87966433) has the molecular formula C22H24N2O7P2S and a molecular weight of 522.46 g/mol. Its IUPAC name is [1-[6-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethoxy]-1H-indol-2-yl]-2-phosphonoethyl]phosphonic acid.
| Compound Name | [1-[6-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethoxy]-1H-indol-2-yl]-2-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 87966433 |
| Molecular Formula | C22H24N2O7P2S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | [1-[6-[2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)ethoxy]-1H-indol-2-yl]-2-phosphonoethyl]phosphonic acid |
| SMILES | Cc1sc(-c2ccccc2)nc1CCOc1ccc2cc(C(CP(=O)(O)O)P(=O)(O)O)[nH]c2c1 |
| InChI | InChI=1S/C22H24N2O7P2S/c1-14-18(24-22(34-14)15-5-3-2-4-6-15)9-10-31-17-8-7-16-11-20(23-19(16)12-17)21(33(28,29)30)13-32(25,26)27/h2-8,11-12,21,23H,9-10,13H2,1H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | XNUGCUIBWMZQMF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 152.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|